C18H18N4O — CID 142314568
(4aR,7aS)-4-(6-phenyl-2-pyridinyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile (PubChem CID 142314568) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is (4aR,7aS)-4-(6-phenyl-2-pyridinyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile.
| Compound Name | (4aR,7aS)-4-(6-phenyl-2-pyridinyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile |
|---|---|
| PubChem CID | 142314568 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (4aR,7aS)-4-(6-phenyl-2-pyridinyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonitrile |
| SMILES | N#CN1C[C@@H]2OCCN(c3cccc(-c4ccccc4)n3)[C@@H]2C1 |
| InChI | InChI=1S/C18H18N4O/c19-13-21-11-16-17(12-21)23-10-9-22(16)18-8-4-7-15(20-18)14-5-2-1-3-6-14/h1-8,16-17H,9-12H2/t16-,17+/m1/s1 |
| InChIKey | KFIIQNCQDKTTBK-SJORKVTESA-N |
| XLogP | 2.12 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|