C41H29N5 — CID 142315008
12-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9-dimethyl-5-phenylindolo[3,2-c]carbazole (PubChem CID 142315008) has the molecular formula C41H29N5 and a molecular weight of 591.72 g/mol. Its IUPAC name is 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9-dimethyl-5-phenylindolo[3,2-c]carbazole.
| Compound Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9-dimethyl-5-phenylindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 142315008 |
| Molecular Formula | C41H29N5 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,9-dimethyl-5-phenylindolo[3,2-c]carbazole |
| SMILES | Cc1ccc2c(c1)c1c(ccc3c4cc(C)ccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c31)n2-c1ccccc1 |
| InChI | InChI=1S/C41H29N5/c1-26-18-21-34-32(24-26)31-20-23-36-37(33-25-27(2)19-22-35(33)45(36)30-16-10-5-11-17-30)38(31)46(34)41-43-39(28-12-6-3-7-13-28)42-40(44-41)29-14-8-4-9-15-29/h3-25H,1-2H3 |
| InChIKey | UEBOCXKTAGCDSG-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |