C39H73NO — CID 142315405
(11Z,14Z)-2-(aminomethyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol (PubChem CID 142315405) has the molecular formula C39H73NO and a molecular weight of 572.02 g/mol. Its IUPAC name is (11Z,14Z)-2-(aminomethyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol.
| Compound Name | (11Z,14Z)-2-(aminomethyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol |
|---|---|
| PubChem CID | 142315405 |
| Molecular Formula | C39H73NO |
| Molecular Weight | 572.02 g/mol |
| Exact Mass | 571.57 |
| IUPAC Name | (11Z,14Z)-2-(aminomethyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CN)(CO)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C39H73NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(37-40,38-41)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,41H,3-10,15-16,21-38,40H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | KIBGJQJNLYYPPC-MAZCIEHSSA-N |
| XLogP | 12.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.02 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|