C24H12N2O2 — CID 142316288
6,19-dihydroxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,9,11,13,15,17(22),18,20-undecaene-12,13-dicarbonitrile (PubChem CID 142316288) has the molecular formula C24H12N2O2 and a molecular weight of 360.37 g/mol. Its IUPAC name is 6,19-dihydroxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,9,11,13,15,17(22),18,20-undecaene-12,13-dicarbonitrile.
| Compound Name | 6,19-dihydroxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,9,11,13,15,17(22),18,20-undecaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 142316288 |
| Molecular Formula | C24H12N2O2 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 6,19-dihydroxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,9,11,13,15,17(22),18,20-undecaene-12,13-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c2ccc3cc(O)ccc3c2c2c1ccc1cc(O)ccc12 |
| InChI | InChI=1S/C24H12N2O2/c25-11-21-19-5-1-13-9-15(27)3-7-17(13)23(19)24-18-8-4-16(28)10-14(18)2-6-20(24)22(21)12-26/h1-10,27-28H |
| InChIKey | RFBUIZPSBPGEOF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|