About 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane
3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane (PubChem CID 142316387) has the molecular formula C16H17Cl2FNOP
and a molecular weight of 360.20 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane.
Molecular Properties
| Compound Name | 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane |
| PubChem CID | 142316387 |
| Molecular Formula | C16H17Cl2FNOP |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane |
| SMILES | CC.O=CCCc1c(-c2ccc(P)cc2F)cc(Cl)nc1Cl |
| InChI | InChI=1S/C14H11Cl2FNOP.C2H6/c15-13-7-11(9-4-3-8(20)6-12(9)17)10(2-1-5-19)14(16)18-13;1-2/h3-7H,1-2,20H2;1-2H3 |
| InChIKey | VOSWJDVZXMEIEZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane?
The IUPAC name of 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane (CID 142316387) is 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane.
What is the SMILES notation for 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane?
The canonical SMILES for 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane is CC.O=CCCc1c(-c2ccc(P)cc2F)cc(Cl)nc1Cl.
What is the InChIKey of 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane?
The InChIKey is VOSWJDVZXMEIEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2FNOP.C2H6/c15-13-7-11(9-4-3-8(20)6-12(9)17)10(2-1-5-19)14(16)18-13;1-2/h3-7H,1-2,20H2;1-2H3.
What are the key properties of 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane?
3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane has a molecular weight of 360.20 g/mol, XLogP of 4.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-dichloro-4-(2-fluoro-4-phosphanylphenyl)-3-pyridinyl]propanal;ethane is sourced from PubChem (CID 142316387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).