C15H14FN2O2P — CID 142316392
5-(2-fluoro-4-phosphanylphenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide (PubChem CID 142316392) has the molecular formula C15H14FN2O2P and a molecular weight of 304.26 g/mol. Its IUPAC name is 5-(2-fluoro-4-phosphanylphenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide.
| Compound Name | 5-(2-fluoro-4-phosphanylphenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 142316392 |
| Molecular Formula | C15H14FN2O2P |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 5-(2-fluoro-4-phosphanylphenyl)-3,4-dihydro-2H-pyrano[2,3-b]pyridine-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(P)cc2F)c2c(n1)OCCC2 |
| InChI | InChI=1S/C15H14FN2O2P/c16-12-6-8(21)3-4-9(12)11-7-13(14(17)19)18-15-10(11)2-1-5-20-15/h3-4,6-7H,1-2,5,21H2,(H2,17,19) |
| InChIKey | UCHZCHYJKDYKNF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|