About tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene
tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene (PubChem CID 142316671) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene.
Molecular Properties
| Compound Name | tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene |
| PubChem CID | 142316671 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.CCCNC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H22N2O2.C5H8/c1-5-6-12-9-7-13(8-9)10(14)15-11(2,3)4;1-4-5(2)3/h9,12H,5-8H2,1-4H3;4H,1-2H2,3H3 |
| InChIKey | MGWPZHALUPUQJD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene?
The IUPAC name of tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene (CID 142316671) is tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene.
What is the SMILES notation for tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene?
The canonical SMILES for tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene is C=CC(=C)C.CCCNC1CN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene?
The InChIKey is MGWPZHALUPUQJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2.C5H8/c1-5-6-12-9-7-13(8-9)10(14)15-11(2,3)4;1-4-5(2)3/h9,12H,5-8H2,1-4H3;4H,1-2H2,3H3.
What are the key properties of tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene?
tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene has a molecular weight of 282.43 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(propylamino)azetidine-1-carboxylate;2-methylbuta-1,3-diene is sourced from PubChem (CID 142316671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).