C21H21F3N6O3 — CID 142316808
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-pyrimidin-2-yl-3-(trifluoromethyl)pyrazole-5-carboxamide;ethane (PubChem CID 142316808) has the molecular formula C21H21F3N6O3 and a molecular weight of 462.43 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-pyrimidin-2-yl-3-(trifluoromethyl)pyrazole-5-carboxamide;ethane.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-pyrimidin-2-yl-3-(trifluoromethyl)pyrazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 142316808 |
| Molecular Formula | C21H21F3N6O3 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-pyrimidin-2-yl-3-(trifluoromethyl)pyrazole-5-carboxamide;ethane |
| SMILES | CC.NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cc(C(F)(F)F)nn1-c1ncccn1 |
| InChI | InChI=1S/C19H15F3N6O3.C2H6/c20-19(21,22)14-10-13(28(27-14)18-24-7-4-8-25-18)17(31)26-12(15(29)16(23)30)9-11-5-2-1-3-6-11;1-2/h1-8,10,12H,9H2,(H2,23,30)(H,26,31);1-2H3 |
| InChIKey | UAJHSOAHYILZGF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|