C31H37N3O5 — CID 142316974
acetic acid;methyl 2-[3-methyl-N-(methylideneamino)-4-[(3-phenylpropanoylamino)methyl]anilino]prop-2-enoate;toluene (PubChem CID 142316974) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is acetic acid;methyl 2-[3-methyl-N-(methylideneamino)-4-[(3-phenylpropanoylamino)methyl]anilino]prop-2-enoate;toluene.
| Compound Name | acetic acid;methyl 2-[3-methyl-N-(methylideneamino)-4-[(3-phenylpropanoylamino)methyl]anilino]prop-2-enoate;toluene |
|---|---|
| PubChem CID | 142316974 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | acetic acid;methyl 2-[3-methyl-N-(methylideneamino)-4-[(3-phenylpropanoylamino)methyl]anilino]prop-2-enoate;toluene |
| SMILES | C=NN(C(=C)C(=O)OC)c1ccc(CNC(=O)CCc2ccccc2)c(C)c1.CC(=O)O.Cc1ccccc1 |
| InChI | InChI=1S/C22H25N3O3.C7H8.C2H4O2/c1-16-14-20(25(23-3)17(2)22(27)28-4)12-11-19(16)15-24-21(26)13-10-18-8-6-5-7-9-18;1-7-5-3-2-4-6-7;1-2(3)4/h5-9,11-12,14H,2-3,10,13,15H2,1,4H3,(H,24,26);2-6H,1H3;1H3,(H,3,4) |
| InChIKey | CIZRRCHNDHQONX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|