C25H32N8O — CID 142317276
1-ethyl-4-[4-methanimidoyl-5-(propan-2-ylamino)-6-[[(1R)-1-quinolin-3-ylethyl]amino]pyrimidin-2-yl]piperazin-2-one (PubChem CID 142317276) has the molecular formula C25H32N8O and a molecular weight of 460.59 g/mol. Its IUPAC name is 1-ethyl-4-[4-methanimidoyl-5-(propan-2-ylamino)-6-[[(1R)-1-quinolin-3-ylethyl]amino]pyrimidin-2-yl]piperazin-2-one.
| Compound Name | 1-ethyl-4-[4-methanimidoyl-5-(propan-2-ylamino)-6-[[(1R)-1-quinolin-3-ylethyl]amino]pyrimidin-2-yl]piperazin-2-one |
|---|---|
| PubChem CID | 142317276 |
| Molecular Formula | C25H32N8O |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 1-ethyl-4-[4-methanimidoyl-5-(propan-2-ylamino)-6-[[(1R)-1-quinolin-3-ylethyl]amino]pyrimidin-2-yl]piperazin-2-one |
| SMILES | [H]/N=C/c1nc(N2CCN(CC)C(=O)C2)nc(N[C@H](C)c2cnc3ccccc3c2)c1NC(C)C |
| InChI | InChI=1S/C25H32N8O/c1-5-32-10-11-33(15-22(32)34)25-30-21(13-26)23(28-16(2)3)24(31-25)29-17(4)19-12-18-8-6-7-9-20(18)27-14-19/h6-9,12-14,16-17,26,28H,5,10-11,15H2,1-4H3,(H,29,30,31)/b26-13+/t17-/m1/s1 |
| InChIKey | QFALAZYKIHDSLS-FCLYZYNOSA-N |
| XLogP | 3.68 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|