C26H45N2P — CID 142317464
N-tert-butyl-1-dicyclohexylphosphanyl-N'-[2-(4-methylcyclohexa-1,5-dien-1-yl)ethyl]methanimidamide (PubChem CID 142317464) has the molecular formula C26H45N2P and a molecular weight of 416.63 g/mol. Its IUPAC name is N-tert-butyl-1-dicyclohexylphosphanyl-N'-[2-(4-methylcyclohexa-1,5-dien-1-yl)ethyl]methanimidamide.
| Compound Name | N-tert-butyl-1-dicyclohexylphosphanyl-N'-[2-(4-methylcyclohexa-1,5-dien-1-yl)ethyl]methanimidamide |
|---|---|
| PubChem CID | 142317464 |
| Molecular Formula | C26H45N2P |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | N-tert-butyl-1-dicyclohexylphosphanyl-N'-[2-(4-methylcyclohexa-1,5-dien-1-yl)ethyl]methanimidamide |
| SMILES | CC1C=CC(CC/N=C(\NC(C)(C)C)P(C2CCCCC2)C2CCCCC2)=CC1 |
| InChI | InChI=1S/C26H45N2P/c1-21-15-17-22(18-16-21)19-20-27-25(28-26(2,3)4)29(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h15,17-18,21,23-24H,5-14,16,19-20H2,1-4H3,(H,27,28) |
| InChIKey | WRUXYSAWSQFUAK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|