About [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite
[(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite (PubChem CID 142317595) has the molecular formula C8H16FNO
and a molecular weight of 161.22 g/mol. Its IUPAC name is [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite.
Molecular Properties
| Compound Name | [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite |
| PubChem CID | 142317595 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite |
| SMILES | C[C@H](COF)CN1CCCC1 |
| InChI | InChI=1S/C8H16FNO/c1-8(7-11-9)6-10-4-2-3-5-10/h8H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | QOJOCTDBPTUNOH-QMMMGPOBSA-N |
| XLogP | 1.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite?
The IUPAC name of [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite (CID 142317595) is [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite.
What is the SMILES notation for [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite?
The canonical SMILES for [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite is C[C@H](COF)CN1CCCC1.
What is the InChIKey of [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite?
The InChIKey is QOJOCTDBPTUNOH-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H16FNO/c1-8(7-11-9)6-10-4-2-3-5-10/h8H,2-7H2,1H3/t8-/m0/s1.
What are the key properties of [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite?
[(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite has a molecular weight of 161.22 g/mol, XLogP of 1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-methyl-3-pyrrolidin-1-ylpropyl] hypofluorite is sourced from PubChem (CID 142317595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).