C16H27NO5 — CID 142318563
[(3Z)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] carbamate;2-methylhex-2-ene (PubChem CID 142318563) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is [(3Z)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] carbamate;2-methylhex-2-ene.
| Compound Name | [(3Z)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] carbamate;2-methylhex-2-ene |
|---|---|
| PubChem CID | 142318563 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | [(3Z)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] carbamate;2-methylhex-2-ene |
| SMILES | CC1(C)OC(=O)O/C1=C\CCOC(N)=O.CCCC=C(C)C |
| InChI | InChI=1S/C9H13NO5.C7H14/c1-9(2)6(14-8(12)15-9)4-3-5-13-7(10)11;1-4-5-6-7(2)3/h4H,3,5H2,1-2H3,(H2,10,11);6H,4-5H2,1-3H3/b6-4-; |
| InChIKey | HFUFOIXSATXCAM-YHSAGPEESA-N |
| XLogP | 4.05 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|