C16H23BrFN3O2 — CID 142318571
tert-butyl (3S)-3-[[(5-bromo-2-pyridinyl)amino]methyl]-3-fluoropiperidine-1-carboxylate (PubChem CID 142318571) has the molecular formula C16H23BrFN3O2 and a molecular weight of 388.28 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(5-bromo-2-pyridinyl)amino]methyl]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[(5-bromo-2-pyridinyl)amino]methyl]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142318571 |
| Molecular Formula | C16H23BrFN3O2 |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | tert-butyl (3S)-3-[[(5-bromo-2-pyridinyl)amino]methyl]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@](F)(CNc2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C16H23BrFN3O2/c1-15(2,3)23-14(22)21-8-4-7-16(18,11-21)10-20-13-6-5-12(17)9-19-13/h5-6,9H,4,7-8,10-11H2,1-3H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | UGVBJWAHJQLHGN-INIZCTEOSA-N |
| XLogP | 4.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |