C14H19NS — CID 142319170
3-methyl-2-[(3E)-2-methylpenta-1,3-dien-3-yl]-5,6-dihydro-2H-1,3-benzothiazole (PubChem CID 142319170) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 3-methyl-2-[(3E)-2-methylpenta-1,3-dien-3-yl]-5,6-dihydro-2H-1,3-benzothiazole.
| Compound Name | 3-methyl-2-[(3E)-2-methylpenta-1,3-dien-3-yl]-5,6-dihydro-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 142319170 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-methyl-2-[(3E)-2-methylpenta-1,3-dien-3-yl]-5,6-dihydro-2H-1,3-benzothiazole |
| SMILES | C=C(C)/C(=C\C)C1SC2=CCCC=C2N1C |
| InChI | InChI=1S/C14H19NS/c1-5-11(10(2)3)14-15(4)12-8-6-7-9-13(12)16-14/h5,8-9,14H,2,6-7H2,1,3-4H3/b11-5+ |
| InChIKey | RVRKPPFGEIGDSO-VZUCSPMQSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|