About (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane
(5-amino-1,2-dihydropyridin-6-yl)methanol;ethane (PubChem CID 142319175) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane.
Molecular Properties
| Compound Name | (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane |
| PubChem CID | 142319175 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane |
| SMILES | CC.NC1=C(CO)NCC=C1 |
| InChI | InChI=1S/C6H10N2O.C2H6/c7-5-2-1-3-8-6(5)4-9;1-2/h1-2,8-9H,3-4,7H2;1-2H3 |
| InChIKey | YGXSBTBNIZUNIN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane?
The IUPAC name of (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane (CID 142319175) is (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane.
What is the SMILES notation for (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane?
The canonical SMILES for (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane is CC.NC1=C(CO)NCC=C1.
What is the InChIKey of (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane?
The InChIKey is YGXSBTBNIZUNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.C2H6/c7-5-2-1-3-8-6(5)4-9;1-2/h1-2,8-9H,3-4,7H2;1-2H3.
What are the key properties of (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane?
(5-amino-1,2-dihydropyridin-6-yl)methanol;ethane has a molecular weight of 156.23 g/mol, XLogP of 0.33, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-1,2-dihydropyridin-6-yl)methanol;ethane is sourced from PubChem (CID 142319175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).