About 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol
1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol (PubChem CID 142319738) has the molecular formula C15H17BrO3S
and a molecular weight of 357.27 g/mol. Its IUPAC name is 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol.
Molecular Properties
| Compound Name | 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol |
| PubChem CID | 142319738 |
| Molecular Formula | C15H17BrO3S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol |
| SMILES | C=CO.CCCC(=O)c1cc2cc(Br)c(OC)cc2s1 |
| InChI | InChI=1S/C13H13BrO2S.C2H4O/c1-3-4-10(15)13-6-8-5-9(14)11(16-2)7-12(8)17-13;1-2-3/h5-7H,3-4H2,1-2H3;2-3H,1H2 |
| InChIKey | SSWDTYQGWGIHFD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol?
The IUPAC name of 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol (CID 142319738) is 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol.
What is the SMILES notation for 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol?
The canonical SMILES for 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol is C=CO.CCCC(=O)c1cc2cc(Br)c(OC)cc2s1.
What is the InChIKey of 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol?
The InChIKey is SSWDTYQGWGIHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrO2S.C2H4O/c1-3-4-10(15)13-6-8-5-9(14)11(16-2)7-12(8)17-13;1-2-3/h5-7H,3-4H2,1-2H3;2-3H,1H2.
What are the key properties of 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol?
1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol has a molecular weight of 357.27 g/mol, XLogP of 5.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-6-methoxy-1-benzothiophen-2-yl)butan-1-one;ethenol is sourced from PubChem (CID 142319738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).