C10H11BrN6S — CID 142319905
(6-bromoquinazolin-4-yl) N,N'-diamino-N-methylcarbamimidothioate (PubChem CID 142319905) has the molecular formula C10H11BrN6S and a molecular weight of 327.21 g/mol. Its IUPAC name is (6-bromoquinazolin-4-yl) N,N'-diamino-N-methylcarbamimidothioate.
| Compound Name | (6-bromoquinazolin-4-yl) N,N'-diamino-N-methylcarbamimidothioate |
|---|---|
| PubChem CID | 142319905 |
| Molecular Formula | C10H11BrN6S |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | (6-bromoquinazolin-4-yl) N,N'-diamino-N-methylcarbamimidothioate |
| SMILES | CN(N)/C(=N\N)Sc1ncnc2ccc(Br)cc12 |
| InChI | InChI=1S/C10H11BrN6S/c1-17(13)10(16-12)18-9-7-4-6(11)2-3-8(7)14-5-15-9/h2-5H,12-13H2,1H3/b16-10+ |
| InChIKey | MGANYGYNZJGGER-MHWRWJLKSA-N |
| XLogP | 1.52 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|