C25H27N3 — CID 142320683
2-ethylbenzonitrile;3-methyl-5-(4-methylphenyl)-N-prop-1-en-2-ylpyridin-2-amine (PubChem CID 142320683) has the molecular formula C25H27N3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-ethylbenzonitrile;3-methyl-5-(4-methylphenyl)-N-prop-1-en-2-ylpyridin-2-amine.
| Compound Name | 2-ethylbenzonitrile;3-methyl-5-(4-methylphenyl)-N-prop-1-en-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 142320683 |
| Molecular Formula | C25H27N3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-ethylbenzonitrile;3-methyl-5-(4-methylphenyl)-N-prop-1-en-2-ylpyridin-2-amine |
| SMILES | C=C(C)Nc1ncc(-c2ccc(C)cc2)cc1C.CCc1ccccc1C#N |
| InChI | InChI=1S/C16H18N2.C9H9N/c1-11(2)18-16-13(4)9-15(10-17-16)14-7-5-12(3)6-8-14;1-2-8-5-3-4-6-9(8)7-10/h5-10H,1H2,2-4H3,(H,17,18);3-6H,2H2,1H3 |
| InChIKey | YCRXHMRARNGYKR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |