C12H19NS2 — CID 142320709
2-[(2,3-dimethylcyclohepta-1,4,6-trien-1-yl)disulfanyl]-N-methylethanamine (PubChem CID 142320709) has the molecular formula C12H19NS2 and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-[(2,3-dimethylcyclohepta-1,4,6-trien-1-yl)disulfanyl]-N-methylethanamine.
| Compound Name | 2-[(2,3-dimethylcyclohepta-1,4,6-trien-1-yl)disulfanyl]-N-methylethanamine |
|---|---|
| PubChem CID | 142320709 |
| Molecular Formula | C12H19NS2 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[(2,3-dimethylcyclohepta-1,4,6-trien-1-yl)disulfanyl]-N-methylethanamine |
| SMILES | CNCCSSC1=C(C)C(C)C=CC=C1 |
| InChI | InChI=1S/C12H19NS2/c1-10-6-4-5-7-12(11(10)2)15-14-9-8-13-3/h4-7,10,13H,8-9H2,1-3H3 |
| InChIKey | HDUYHYIOOZIIFB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|