About 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane
4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane (PubChem CID 142320936) has the molecular formula C21H33ClN2O2
and a molecular weight of 380.96 g/mol. Its IUPAC name is 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane.
Molecular Properties
| Compound Name | 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane |
| PubChem CID | 142320936 |
| Molecular Formula | C21H33ClN2O2 |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane |
| SMILES | CC.CN(C)C(=O)c1ccc(OCCC2CC3(CCNCC3)C2)cc1Cl |
| InChI | InChI=1S/C19H27ClN2O2.C2H6/c1-22(2)18(23)16-4-3-15(11-17(16)20)24-10-5-14-12-19(13-14)6-8-21-9-7-19;1-2/h3-4,11,14,21H,5-10,12-13H2,1-2H3;1-2H3 |
| InChIKey | DOARDJBODUDXBT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane?
The IUPAC name of 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane (CID 142320936) is 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane.
What is the SMILES notation for 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane?
The canonical SMILES for 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane is CC.CN(C)C(=O)c1ccc(OCCC2CC3(CCNCC3)C2)cc1Cl.
What is the InChIKey of 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane?
The InChIKey is DOARDJBODUDXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27ClN2O2.C2H6/c1-22(2)18(23)16-4-3-15(11-17(16)20)24-10-5-14-12-19(13-14)6-8-21-9-7-19;1-2/h3-4,11,14,21H,5-10,12-13H2,1-2H3;1-2H3.
What are the key properties of 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane?
4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane has a molecular weight of 380.96 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-chloro-N,N-dimethylbenzamide;ethane is sourced from PubChem (CID 142320936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).