C11H18N2 — CID 142321782
(5R)-3,3,5-trimethyl-5,6,7,8-tetrahydropyrido[1,2-b]pyridazine (PubChem CID 142321782) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (5R)-3,3,5-trimethyl-5,6,7,8-tetrahydropyrido[1,2-b]pyridazine.
| Compound Name | (5R)-3,3,5-trimethyl-5,6,7,8-tetrahydropyrido[1,2-b]pyridazine |
|---|---|
| PubChem CID | 142321782 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (5R)-3,3,5-trimethyl-5,6,7,8-tetrahydropyrido[1,2-b]pyridazine |
| SMILES | C[C@@H]1CCCN2N=CC(C)(C)C=C12 |
| InChI | InChI=1S/C11H18N2/c1-9-5-4-6-13-10(9)7-11(2,3)8-12-13/h7-9H,4-6H2,1-3H3/t9-/m1/s1 |
| InChIKey | AZJNFYVVDFXGOM-SECBINFHSA-N |
| XLogP | 2.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |