C9H11N3 — CID 142321821
7,7-dimethyl-[1,2,4]triazolo[1,5-a]azepine (PubChem CID 142321821) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 7,7-dimethyl-[1,2,4]triazolo[1,5-a]azepine.
| Compound Name | 7,7-dimethyl-[1,2,4]triazolo[1,5-a]azepine |
|---|---|
| PubChem CID | 142321821 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 7,7-dimethyl-[1,2,4]triazolo[1,5-a]azepine |
| SMILES | CC1(C)C=Cc2ncnn2C=C1 |
| InChI | InChI=1S/C9H11N3/c1-9(2)4-3-8-10-7-11-12(8)6-5-9/h3-7H,1-2H3 |
| InChIKey | JOFGBFPRLAAPTQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |