About 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne
1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne (PubChem CID 142322103) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne.
Molecular Properties
| Compound Name | 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne |
| PubChem CID | 142322103 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne |
| SMILES | C#C/C=C\CCC.CC1(C)CCCCC1 |
| InChI | InChI=1S/C8H16.C7H10/c1-8(2)6-4-3-5-7-8;1-3-5-7-6-4-2/h3-7H2,1-2H3;1,5,7H,4,6H2,2H3/b;7-5- |
| InChIKey | LRLBRQWBIOVJAM-GMLUHMIMSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne?
The IUPAC name of 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne (CID 142322103) is 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne.
What is the SMILES notation for 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne?
The canonical SMILES for 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne is C#C/C=C\CCC.CC1(C)CCCCC1.
What is the InChIKey of 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne?
The InChIKey is LRLBRQWBIOVJAM-GMLUHMIMSA-N. The full InChI is InChI=1S/C8H16.C7H10/c1-8(2)6-4-3-5-7-8;1-3-5-7-6-4-2/h3-7H2,1-2H3;1,5,7H,4,6H2,2H3/b;7-5-.
What are the key properties of 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne?
1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne has a molecular weight of 206.37 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylcyclohexane;(Z)-hept-3-en-1-yne is sourced from PubChem (CID 142322103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).