C28H34N4O5 — CID 142322152
4-[(3aS,9bR)-8-ethoxy-7-methoxy-1,3,3a,9b-tetrahydrofuro[3,4-c]isoquinolin-5-yl]-N-[dimethylamino(morpholin-4-yl)methylidene]benzamide (PubChem CID 142322152) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is 4-[(3aS,9bR)-8-ethoxy-7-methoxy-1,3,3a,9b-tetrahydrofuro[3,4-c]isoquinolin-5-yl]-N-[dimethylamino(morpholin-4-yl)methylidene]benzamide.
| Compound Name | 4-[(3aS,9bR)-8-ethoxy-7-methoxy-1,3,3a,9b-tetrahydrofuro[3,4-c]isoquinolin-5-yl]-N-[dimethylamino(morpholin-4-yl)methylidene]benzamide |
|---|---|
| PubChem CID | 142322152 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 4-[(3aS,9bR)-8-ethoxy-7-methoxy-1,3,3a,9b-tetrahydrofuro[3,4-c]isoquinolin-5-yl]-N-[dimethylamino(morpholin-4-yl)methylidene]benzamide |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(C(=O)/N=C(\N(C)C)N3CCOCC3)cc1)=N[C@@H]1COC[C@H]21 |
| InChI | InChI=1S/C28H34N4O5/c1-5-37-25-14-20-21(15-24(25)34-4)26(29-23-17-36-16-22(20)23)18-6-8-19(9-7-18)27(33)30-28(31(2)3)32-10-12-35-13-11-32/h6-9,14-15,22-23H,5,10-13,16-17H2,1-4H3/b30-28+/t22-,23-/m1/s1 |
| InChIKey | MAXGXPZYRSSKJT-MSDNKDKASA-N |
| XLogP | 2.82 |
| TPSA | 85.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|