About 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol
2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol (PubChem CID 142322190) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol.
Analyze 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol?
The IUPAC name of 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol (CID 142322190) is 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol.
What is the SMILES notation for 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol?
The canonical SMILES for 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol is Cc1c2c(nn1C)CCC2O.
What is the InChIKey of 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol?
The InChIKey is AFNVSZNTMGBDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-5-8-6(9-10(5)2)3-4-7(8)11/h7,11H,3-4H2,1-2H3.
What are the key properties of 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol?
2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol has a molecular weight of 152.20 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-ol is sourced from PubChem (CID 142322190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).