About 4-methylpyrido[3,4-b]azepin-4-amine
4-methylpyrido[3,4-b]azepin-4-amine (PubChem CID 142322490) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 4-methylpyrido[3,4-b]azepin-4-amine.
Molecular Properties
| Compound Name | 4-methylpyrido[3,4-b]azepin-4-amine |
| PubChem CID | 142322490 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 4-methylpyrido[3,4-b]azepin-4-amine |
| SMILES | CC1(N)C=CN=c2cnccc2=C1 |
| InChI | InChI=1S/C10H11N3/c1-10(11)3-5-13-9-7-12-4-2-8(9)6-10/h2-7H,11H2,1H3 |
| InChIKey | QHZFOPRDRFKXRR-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylpyrido[3,4-b]azepin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyrido[3,4-b]azepin-4-amine?
The IUPAC name of 4-methylpyrido[3,4-b]azepin-4-amine (CID 142322490) is 4-methylpyrido[3,4-b]azepin-4-amine.
What is the SMILES notation for 4-methylpyrido[3,4-b]azepin-4-amine?
The canonical SMILES for 4-methylpyrido[3,4-b]azepin-4-amine is CC1(N)C=CN=c2cnccc2=C1.
What is the InChIKey of 4-methylpyrido[3,4-b]azepin-4-amine?
The InChIKey is QHZFOPRDRFKXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-10(11)3-5-13-9-7-12-4-2-8(9)6-10/h2-7H,11H2,1H3.
What are the key properties of 4-methylpyrido[3,4-b]azepin-4-amine?
4-methylpyrido[3,4-b]azepin-4-amine has a molecular weight of 173.22 g/mol, XLogP of -0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyrido[3,4-b]azepin-4-amine is sourced from PubChem (CID 142322490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).