C16H23NO5 — CID 142322506
2-(2-aminoprop-2-enoxy)-3-methoxybenzaldehyde;2-methylbutanoic acid (PubChem CID 142322506) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-(2-aminoprop-2-enoxy)-3-methoxybenzaldehyde;2-methylbutanoic acid.
| Compound Name | 2-(2-aminoprop-2-enoxy)-3-methoxybenzaldehyde;2-methylbutanoic acid |
|---|---|
| PubChem CID | 142322506 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-(2-aminoprop-2-enoxy)-3-methoxybenzaldehyde;2-methylbutanoic acid |
| SMILES | C=C(N)COc1c(C=O)cccc1OC.CCC(C)C(=O)O |
| InChI | InChI=1S/C11H13NO3.C5H10O2/c1-8(12)7-15-11-9(6-13)4-3-5-10(11)14-2;1-3-4(2)5(6)7/h3-6H,1,7,12H2,2H3;4H,3H2,1-2H3,(H,6,7) |
| InChIKey | BPBUJVPDEMTTJO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|