About ethane;4-oxopentanimidamide
ethane;4-oxopentanimidamide (PubChem CID 142322698) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is ethane;4-oxopentanimidamide.
Molecular Properties
| Compound Name | ethane;4-oxopentanimidamide |
| PubChem CID | 142322698 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | ethane;4-oxopentanimidamide |
| SMILES | CC.[H]/N=C(\N)CCC(C)=O |
| InChI | InChI=1S/C5H10N2O.C2H6/c1-4(8)2-3-5(6)7;1-2/h2-3H2,1H3,(H3,6,7);1-2H3 |
| InChIKey | UJAAWAQFRLCNNQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-oxopentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-oxopentanimidamide?
The IUPAC name of ethane;4-oxopentanimidamide (CID 142322698) is ethane;4-oxopentanimidamide.
What is the SMILES notation for ethane;4-oxopentanimidamide?
The canonical SMILES for ethane;4-oxopentanimidamide is CC.[H]/N=C(\N)CCC(C)=O.
What is the InChIKey of ethane;4-oxopentanimidamide?
The InChIKey is UJAAWAQFRLCNNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.C2H6/c1-4(8)2-3-5(6)7;1-2/h2-3H2,1H3,(H3,6,7);1-2H3.
What are the key properties of ethane;4-oxopentanimidamide?
ethane;4-oxopentanimidamide has a molecular weight of 144.22 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-oxopentanimidamide is sourced from PubChem (CID 142322698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).