C18H19ClF3N3 — CID 142322913
N'-[2-chloro-5-methyl-4-(3,4,5-trifluoro-N-methylanilino)phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 142322913) has the molecular formula C18H19ClF3N3 and a molecular weight of 369.82 g/mol. Its IUPAC name is N'-[2-chloro-5-methyl-4-(3,4,5-trifluoro-N-methylanilino)phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-5-methyl-4-(3,4,5-trifluoro-N-methylanilino)phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 142322913 |
| Molecular Formula | C18H19ClF3N3 |
| Molecular Weight | 369.82 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N'-[2-chloro-5-methyl-4-(3,4,5-trifluoro-N-methylanilino)phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(N(C)c2cc(F)c(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C18H19ClF3N3/c1-5-24(3)10-23-16-6-11(2)17(9-13(16)19)25(4)12-7-14(20)18(22)15(21)8-12/h6-10H,5H2,1-4H3/b23-10+ |
| InChIKey | XRLKWEKQXCUKHE-AUEPDCJTSA-N |
| XLogP | 5.45 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.82 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|