About 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride
2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride (PubChem CID 142323036) has the molecular formula C10H10ClFN2OS
and a molecular weight of 260.72 g/mol. Its IUPAC name is 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride.
Molecular Properties
| Compound Name | 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride |
| PubChem CID | 142323036 |
| Molecular Formula | C10H10ClFN2OS |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.Fc1ccc2nc(OC3CNC3)sc2c1 |
| InChI | InChI=1S/C10H9FN2OS.ClH/c11-6-1-2-8-9(3-6)15-10(13-8)14-7-4-12-5-7;/h1-3,7,12H,4-5H2;1H |
| InChIKey | AWVLZTCIYXRSAL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride?
The IUPAC name of 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride (CID 142323036) is 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride.
What is the SMILES notation for 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride?
The canonical SMILES for 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride is Cl.Fc1ccc2nc(OC3CNC3)sc2c1.
What is the InChIKey of 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride?
The InChIKey is AWVLZTCIYXRSAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2OS.ClH/c11-6-1-2-8-9(3-6)15-10(13-8)14-7-4-12-5-7;/h1-3,7,12H,4-5H2;1H.
What are the key properties of 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride?
2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride has a molecular weight of 260.72 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-3-yloxy)-6-fluoro-1,3-benzothiazole;hydrochloride is sourced from PubChem (CID 142323036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).