About 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol
7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol (PubChem CID 142323074) has the molecular formula C22H33NO4
and a molecular weight of 375.51 g/mol. Its IUPAC name is 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol.
Molecular Properties
| Compound Name | 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol |
| PubChem CID | 142323074 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol |
| SMILES | CC(C)O.O=CNC1CCCCC1.c1cc(OC2CCC2)c2occc2c1 |
| InChI | InChI=1S/C12H12O2.C7H13NO.C3H8O/c1-3-9-7-8-13-12(9)11(6-1)14-10-4-2-5-10;9-6-8-7-4-2-1-3-5-7;1-3(2)4/h1,3,6-8,10H,2,4-5H2;6-7H,1-5H2,(H,8,9);3-4H,1-2H3 |
| InChIKey | GQLJBECAJLEQKA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol?
The IUPAC name of 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol (CID 142323074) is 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol.
What is the SMILES notation for 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol?
The canonical SMILES for 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol is CC(C)O.O=CNC1CCCCC1.c1cc(OC2CCC2)c2occc2c1.
What is the InChIKey of 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol?
The InChIKey is GQLJBECAJLEQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2.C7H13NO.C3H8O/c1-3-9-7-8-13-12(9)11(6-1)14-10-4-2-5-10;9-6-8-7-4-2-1-3-5-7;1-3(2)4/h1,3,6-8,10H,2,4-5H2;6-7H,1-5H2,(H,8,9);3-4H,1-2H3.
What are the key properties of 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol?
7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol has a molecular weight of 375.51 g/mol, XLogP of 4.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclobutyloxy-1-benzofuran;N-cyclohexylformamide;propan-2-ol is sourced from PubChem (CID 142323074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).