About 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide
2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide (PubChem CID 142323092) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide.
Molecular Properties
| Compound Name | 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide |
| PubChem CID | 142323092 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide |
| SMILES | CC1(NC=O)CN(c2cccnn2)C1.COC(C)(C)C |
| InChI | InChI=1S/C9H12N4O.C5H12O/c1-9(10-7-14)5-13(6-9)8-3-2-4-11-12-8;1-5(2,3)6-4/h2-4,7H,5-6H2,1H3,(H,10,14);1-4H3 |
| InChIKey | KGHJSBOQKXJEKJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide?
The IUPAC name of 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide (CID 142323092) is 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide.
What is the SMILES notation for 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide?
The canonical SMILES for 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide is CC1(NC=O)CN(c2cccnn2)C1.COC(C)(C)C.
What is the InChIKey of 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide?
The InChIKey is KGHJSBOQKXJEKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O.C5H12O/c1-9(10-7-14)5-13(6-9)8-3-2-4-11-12-8;1-5(2,3)6-4/h2-4,7H,5-6H2,1H3,(H,10,14);1-4H3.
What are the key properties of 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide?
2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide has a molecular weight of 280.37 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-methylpropane;N-(3-methyl-1-pyridazin-3-ylazetidin-3-yl)formamide is sourced from PubChem (CID 142323092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).