C56H42N4O — CID 142324064
(Z)-3-imino-1-phenyl-3-[8-(10-phenylphenoxazin-3-yl)benzo[c]carbazol-7-yl]prop-1-en-1-amine;1-methyl-4-phenylbenzene (PubChem CID 142324064) has the molecular formula C56H42N4O and a molecular weight of 786.98 g/mol. Its IUPAC name is (Z)-3-imino-1-phenyl-3-[8-(10-phenylphenoxazin-3-yl)benzo[c]carbazol-7-yl]prop-1-en-1-amine;1-methyl-4-phenylbenzene.
| Compound Name | (Z)-3-imino-1-phenyl-3-[8-(10-phenylphenoxazin-3-yl)benzo[c]carbazol-7-yl]prop-1-en-1-amine;1-methyl-4-phenylbenzene |
|---|---|
| PubChem CID | 142324064 |
| Molecular Formula | C56H42N4O |
| Molecular Weight | 786.98 g/mol |
| Exact Mass | 786.34 |
| IUPAC Name | (Z)-3-imino-1-phenyl-3-[8-(10-phenylphenoxazin-3-yl)benzo[c]carbazol-7-yl]prop-1-en-1-amine;1-methyl-4-phenylbenzene |
| SMILES | Cc1ccc(-c2ccccc2)cc1.[H]/N=C(\C=C(/N)c1ccccc1)n1c2ccc3ccccc3c2c2cccc(-c3ccc4c(c3)Oc3ccccc3N4c3ccccc3)c21 |
| InChI | InChI=1S/C43H30N4O.C13H12/c44-35(29-13-3-1-4-14-29)27-41(45)47-38-25-22-28-12-7-8-17-32(28)42(38)34-19-11-18-33(43(34)47)30-23-24-37-40(26-30)48-39-21-10-9-20-36(39)46(37)31-15-5-2-6-16-31;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h1-27,45H,44H2;2-10H,1H3/b35-27-,45-41+; |
| InChIKey | NXDLCTWIVPZLKF-AFCIBZHUSA-N |
| XLogP | 14.68 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.98 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|