About 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal
2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal (PubChem CID 142325276) has the molecular formula C9H5F5O
and a molecular weight of 224.13 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal |
| PubChem CID | 142325276 |
| Molecular Formula | C9H5F5O |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal |
| SMILES | O=CC(c1cc(F)cc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C9H5F5O/c10-6-1-5(2-7(11)3-6)8(4-15)9(12,13)14/h1-4,8H |
| InChIKey | QLNQXBUVAXWDJX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal?
The IUPAC name of 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal (CID 142325276) is 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal.
What is the SMILES notation for 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal?
The canonical SMILES for 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal is O=CC(c1cc(F)cc(F)c1)C(F)(F)F.
What is the InChIKey of 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal?
The InChIKey is QLNQXBUVAXWDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F5O/c10-6-1-5(2-7(11)3-6)8(4-15)9(12,13)14/h1-4,8H.
What are the key properties of 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal?
2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal has a molecular weight of 224.13 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-3,3,3-trifluoropropanal is sourced from PubChem (CID 142325276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).