C27H28N8O2 — CID 142325437
2-amino-N-[(3R)-1-[[3-(4-aminophenyl)phenyl]carbamoyl]pyrrolidin-3-yl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide (PubChem CID 142325437) has the molecular formula C27H28N8O2 and a molecular weight of 496.58 g/mol. Its IUPAC name is 2-amino-N-[(3R)-1-[[3-(4-aminophenyl)phenyl]carbamoyl]pyrrolidin-3-yl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[(3R)-1-[[3-(4-aminophenyl)phenyl]carbamoyl]pyrrolidin-3-yl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142325437 |
| Molecular Formula | C27H28N8O2 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 2-amino-N-[(3R)-1-[[3-(4-aminophenyl)phenyl]carbamoyl]pyrrolidin-3-yl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide |
| SMILES | Cn1cc(-c2cnc(N)c(C(=O)N[C@@H]3CCN(C(=O)Nc4cccc(-c5ccc(N)cc5)c4)C3)c2)cn1 |
| InChI | InChI=1S/C27H28N8O2/c1-34-15-20(14-31-34)19-12-24(25(29)30-13-19)26(36)32-23-9-10-35(16-23)27(37)33-22-4-2-3-18(11-22)17-5-7-21(28)8-6-17/h2-8,11-15,23H,9-10,16,28H2,1H3,(H2,29,30)(H,32,36)(H,33,37)/t23-/m1/s1 |
| InChIKey | KGIAHZNSXSSPDB-HSZRJFAPSA-N |
| XLogP | 3.35 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|