C27H49N5 — CID 142326438
(2E,6E,8Z)-2-[(3-aminocyclobutyl)methyl]-1-N-ethenyl-3-N-[(E)-2-ethenylbut-2-enyl]-4-methylnona-2,6,8-triene-1,3,9-triamine;ethane;ethenamine (PubChem CID 142326438) has the molecular formula C27H49N5 and a molecular weight of 443.72 g/mol. Its IUPAC name is (2E,6E,8Z)-2-[(3-aminocyclobutyl)methyl]-1-N-ethenyl-3-N-[(E)-2-ethenylbut-2-enyl]-4-methylnona-2,6,8-triene-1,3,9-triamine;ethane;ethenamine.
| Compound Name | (2E,6E,8Z)-2-[(3-aminocyclobutyl)methyl]-1-N-ethenyl-3-N-[(E)-2-ethenylbut-2-enyl]-4-methylnona-2,6,8-triene-1,3,9-triamine;ethane;ethenamine |
|---|---|
| PubChem CID | 142326438 |
| Molecular Formula | C27H49N5 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.40 |
| IUPAC Name | (2E,6E,8Z)-2-[(3-aminocyclobutyl)methyl]-1-N-ethenyl-3-N-[(E)-2-ethenylbut-2-enyl]-4-methylnona-2,6,8-triene-1,3,9-triamine;ethane;ethenamine |
| SMILES | C=CN.C=CNC/C(CC1CC(N)C1)=C(/NC/C(C=C)=C/C)C(C)C/C=C/C=C\N.CC |
| InChI | InChI=1S/C23H38N4.C2H5N.C2H6/c1-5-19(6-2)16-27-23(18(4)11-9-8-10-12-24)21(17-26-7-3)13-20-14-22(25)15-20;1-2-3;1-2/h5-10,12,18,20,22,26-27H,1,3,11,13-17,24-25H2,2,4H3;2H,1,3H2;1-2H3/b9-8+,12-10-,19-6+,23-21+;; |
| InChIKey | OIMVLMWIIVOCCC-NNBUOHARSA-N |
| XLogP | 4.99 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|