C28H28N6O2S — CID 142326598
6-ethoxy-4-[6-[1-(4-methoxyphenyl)sulfanyl-1,6-diazaspiro[2.5]octan-6-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 142326598) has the molecular formula C28H28N6O2S and a molecular weight of 512.64 g/mol. Its IUPAC name is 6-ethoxy-4-[6-[1-(4-methoxyphenyl)sulfanyl-1,6-diazaspiro[2.5]octan-6-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-ethoxy-4-[6-[1-(4-methoxyphenyl)sulfanyl-1,6-diazaspiro[2.5]octan-6-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 142326598 |
| Molecular Formula | C28H28N6O2S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 6-ethoxy-4-[6-[1-(4-methoxyphenyl)sulfanyl-1,6-diazaspiro[2.5]octan-6-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CCOc1cc(-c2ccc(N3CCC4(CC3)CN4Sc3ccc(OC)cc3)nc2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C28H28N6O2S/c1-3-36-23-14-25(27-21(15-29)17-31-33(27)18-23)20-4-9-26(30-16-20)32-12-10-28(11-13-32)19-34(28)37-24-7-5-22(35-2)6-8-24/h4-9,14,16-18H,3,10-13,19H2,1-2H3 |
| InChIKey | MDKCNFLITAOVQI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 78.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|