C11H18N4S — CID 142326672
6-[(1-methylpyrazol-4-yl)methyl]-3-methylsulfanyl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 142326672) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 6-[(1-methylpyrazol-4-yl)methyl]-3-methylsulfanyl-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 6-[(1-methylpyrazol-4-yl)methyl]-3-methylsulfanyl-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 142326672 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 6-[(1-methylpyrazol-4-yl)methyl]-3-methylsulfanyl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | CSN1CC2CC(C1)N2Cc1cnn(C)c1 |
| InChI | InChI=1S/C11H18N4S/c1-13-5-9(4-12-13)6-15-10-3-11(15)8-14(7-10)16-2/h4-5,10-11H,3,6-8H2,1-2H3 |
| InChIKey | HCDFGBBQWOVVJF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|