C14H18F3N3OS — CID 142326740
3-methylsulfanyl-6-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 142326740) has the molecular formula C14H18F3N3OS and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-methylsulfanyl-6-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 3-methylsulfanyl-6-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 142326740 |
| Molecular Formula | C14H18F3N3OS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-methylsulfanyl-6-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | CSN1CC2CC(C1)N2Cc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C14H18F3N3OS/c1-22-19-7-11-4-12(8-19)20(11)6-10-2-3-13(18-5-10)21-9-14(15,16)17/h2-3,5,11-12H,4,6-9H2,1H3 |
| InChIKey | OSRDHIINZJGCDE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|