About N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane
N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane (PubChem CID 142326958) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane |
| PubChem CID | 142326958 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane |
| SMILES | CC.CN1CCC(C)(CNC2CCOCC2)CC1 |
| InChI | InChI=1S/C13H26N2O.C2H6/c1-13(5-7-15(2)8-6-13)11-14-12-3-9-16-10-4-12;1-2/h12,14H,3-11H2,1-2H3;1-2H3 |
| InChIKey | IIRPMPFBIJHGNS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane?
The IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane (CID 142326958) is N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane.
What is the SMILES notation for N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane?
The canonical SMILES for N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane is CC.CN1CCC(C)(CNC2CCOCC2)CC1.
What is the InChIKey of N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane?
The InChIKey is IIRPMPFBIJHGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O.C2H6/c1-13(5-7-15(2)8-6-13)11-14-12-3-9-16-10-4-12;1-2/h12,14H,3-11H2,1-2H3;1-2H3.
What are the key properties of N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane?
N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane has a molecular weight of 256.43 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpiperidin-4-yl)methyl]oxan-4-amine;ethane is sourced from PubChem (CID 142326958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).