About 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine
4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine (PubChem CID 142327140) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine |
| PubChem CID | 142327140 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine |
| SMILES | CN1CCC(OC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C12H19NO/c1-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11/h3,5-6,12H,2,4,7-10H2,1H3 |
| InChIKey | NUACZZSFWSIISF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine (CID 142327140) is 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine is CN1CCC(OC2=CCCC=C2)CC1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine?
The InChIKey is NUACZZSFWSIISF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11/h3,5-6,12H,2,4,7-10H2,1H3.
What are the key properties of 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine?
4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine has a molecular weight of 193.29 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yloxy-1-methylpiperidine is sourced from PubChem (CID 142327140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).