C20H22F3NO2 — CID 142327179
ethyl (Z)-4-(cyclopenten-1-yl)-2-methylidene-4-[N-methyl-2-(trifluoromethyl)anilino]but-3-enoate (PubChem CID 142327179) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is ethyl (Z)-4-(cyclopenten-1-yl)-2-methylidene-4-[N-methyl-2-(trifluoromethyl)anilino]but-3-enoate.
| Compound Name | ethyl (Z)-4-(cyclopenten-1-yl)-2-methylidene-4-[N-methyl-2-(trifluoromethyl)anilino]but-3-enoate |
|---|---|
| PubChem CID | 142327179 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | ethyl (Z)-4-(cyclopenten-1-yl)-2-methylidene-4-[N-methyl-2-(trifluoromethyl)anilino]but-3-enoate |
| SMILES | C=C(/C=C(/C1=CCCC1)N(C)c1ccccc1C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C20H22F3NO2/c1-4-26-19(25)14(2)13-18(15-9-5-6-10-15)24(3)17-12-8-7-11-16(17)20(21,22)23/h7-9,11-13H,2,4-6,10H2,1,3H3/b18-13- |
| InChIKey | XWDKFBGBMDQZKV-AQTBWJFISA-N |
| XLogP | 5.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|