C35H24N4S — CID 142328090
2-(1-methylbenzimidazol-2-yl)-9-(3-pyridin-2-yl-5-thiophen-3-ylphenyl)carbazole (PubChem CID 142328090) has the molecular formula C35H24N4S and a molecular weight of 532.67 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)-9-(3-pyridin-2-yl-5-thiophen-3-ylphenyl)carbazole.
| Compound Name | 2-(1-methylbenzimidazol-2-yl)-9-(3-pyridin-2-yl-5-thiophen-3-ylphenyl)carbazole |
|---|---|
| PubChem CID | 142328090 |
| Molecular Formula | C35H24N4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)-9-(3-pyridin-2-yl-5-thiophen-3-ylphenyl)carbazole |
| SMILES | Cn1c(-c2ccc3c4ccccc4n(-c4cc(-c5ccsc5)cc(-c5ccccn5)c4)c3c2)nc2ccccc21 |
| InChI | InChI=1S/C35H24N4S/c1-38-33-12-5-3-10-31(33)37-35(38)23-13-14-29-28-8-2-4-11-32(28)39(34(29)21-23)27-19-25(24-15-17-40-22-24)18-26(20-27)30-9-6-7-16-36-30/h2-22H,1H3 |
| InChIKey | GXKLXBJRYZDCCW-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |