C34H21N3S2 — CID 142329260
2-[9-[3-(4-thiophen-3-yl-2-pyridinyl)phenyl]carbazol-2-yl]-1,3-benzothiazole (PubChem CID 142329260) has the molecular formula C34H21N3S2 and a molecular weight of 535.70 g/mol. Its IUPAC name is 2-[9-[3-(4-thiophen-3-yl-2-pyridinyl)phenyl]carbazol-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[9-[3-(4-thiophen-3-yl-2-pyridinyl)phenyl]carbazol-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 142329260 |
| Molecular Formula | C34H21N3S2 |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 2-[9-[3-(4-thiophen-3-yl-2-pyridinyl)phenyl]carbazol-2-yl]-1,3-benzothiazole |
| SMILES | c1cc(-c2cc(-c3ccsc3)ccn2)cc(-n2c3ccccc3c3ccc(-c4nc5ccccc5s4)cc32)c1 |
| InChI | InChI=1S/C34H21N3S2/c1-3-10-31-27(8-1)28-13-12-24(34-36-29-9-2-4-11-33(29)39-34)20-32(28)37(31)26-7-5-6-23(18-26)30-19-22(14-16-35-30)25-15-17-38-21-25/h1-21H |
| InChIKey | UFZSCRRNFWSTGT-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |