C34H39FN2O5S — CID 142329682
ethane;11-fluoro-20-hydroxy-2,18-dimethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9,11-tetraene-17-carbothioic S-acid;furan-2-carboxylic acid (PubChem CID 142329682) has the molecular formula C34H39FN2O5S and a molecular weight of 606.76 g/mol. Its IUPAC name is ethane;11-fluoro-20-hydroxy-2,18-dimethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9,11-tetraene-17-carbothioic S-acid;furan-2-carboxylic acid.
| Compound Name | ethane;11-fluoro-20-hydroxy-2,18-dimethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9,11-tetraene-17-carbothioic S-acid;furan-2-carboxylic acid |
|---|---|
| PubChem CID | 142329682 |
| Molecular Formula | C34H39FN2O5S |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | ethane;11-fluoro-20-hydroxy-2,18-dimethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9,11-tetraene-17-carbothioic S-acid;furan-2-carboxylic acid |
| SMILES | CC.CC12Cc3cnn(-c4ccccc4)c3C=C1C(F)=CC1C2C(O)CC2(C)C(C(=O)S)CCC12.O=C(O)c1ccco1 |
| InChI | InChI=1S/C27H29FN2O2S.C5H4O3.C2H6/c1-26-13-23(31)24-17(18(26)8-9-19(26)25(32)33)10-21(28)20-11-22-15(12-27(20,24)2)14-29-30(22)16-6-4-3-5-7-16;6-5(7)4-2-1-3-8-4;1-2/h3-7,10-11,14,17-19,23-24,31H,8-9,12-13H2,1-2H3,(H,32,33);1-3H,(H,6,7);1-2H3 |
| InChIKey | FANGZHRVNNLDEZ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|