C10H16N2OS — CID 142329776
4-(methoxymethyl)-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine (PubChem CID 142329776) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine.
| Compound Name | 4-(methoxymethyl)-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 142329776 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-(methoxymethyl)-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine |
| SMILES | COCc1ccc(N)c(N(C)SC)c1 |
| InChI | InChI=1S/C10H16N2OS/c1-12(14-3)10-6-8(7-13-2)4-5-9(10)11/h4-6H,7,11H2,1-3H3 |
| InChIKey | PRTMAZAXCDZXED-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|