About 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane
6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane (PubChem CID 142329931) has the molecular formula C16H19ClN4O2S
and a molecular weight of 366.87 g/mol. Its IUPAC name is 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane.
Molecular Properties
| Compound Name | 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane |
| PubChem CID | 142329931 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane |
| SMILES | CC.Cn1[nH]c2nc(Cl)cc(Nc3ccccc3S(C)=O)c2c1=O |
| InChI | InChI=1S/C14H13ClN4O2S.C2H6/c1-19-14(20)12-9(7-11(15)17-13(12)18-19)16-8-5-3-4-6-10(8)22(2)21;1-2/h3-7H,1-2H3,(H2,16,17,18);1-2H3 |
| InChIKey | VCADTBWFXDSCMZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane?
The IUPAC name of 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane (CID 142329931) is 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane.
What is the SMILES notation for 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane?
The canonical SMILES for 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane is CC.Cn1[nH]c2nc(Cl)cc(Nc3ccccc3S(C)=O)c2c1=O.
What is the InChIKey of 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane?
The InChIKey is VCADTBWFXDSCMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN4O2S.C2H6/c1-19-14(20)12-9(7-11(15)17-13(12)18-19)16-8-5-3-4-6-10(8)22(2)21;1-2/h3-7H,1-2H3,(H2,16,17,18);1-2H3.
What are the key properties of 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane?
6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane has a molecular weight of 366.87 g/mol, XLogP of 3.42, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-methyl-4-(2-methylsulfinylanilino)-1H-pyrazolo[3,4-b]pyridin-3-one;ethane is sourced from PubChem (CID 142329931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).