About N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine
N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine (PubChem CID 142330113) has the molecular formula C9H17F3N2
and a molecular weight of 210.24 g/mol. Its IUPAC name is N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine |
| PubChem CID | 142330113 |
| Molecular Formula | C9H17F3N2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine |
| SMILES | CNC.NC1CCC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C7H10F3N.C2H7N/c8-7(9,10)5-2-1-3-6(11)4-5;1-3-2/h2,6H,1,3-4,11H2;3H,1-2H3 |
| InChIKey | SVJVGXAHLJEDQF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine?
The IUPAC name of N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine (CID 142330113) is N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine.
What is the SMILES notation for N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine?
The canonical SMILES for N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine is CNC.NC1CCC=C(C(F)(F)F)C1.
What is the InChIKey of N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine?
The InChIKey is SVJVGXAHLJEDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3N.C2H7N/c8-7(9,10)5-2-1-3-6(11)4-5;1-3-2/h2,6H,1,3-4,11H2;3H,1-2H3.
What are the key properties of N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine?
N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine has a molecular weight of 210.24 g/mol, XLogP of 1.82, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;3-(trifluoromethyl)cyclohex-3-en-1-amine is sourced from PubChem (CID 142330113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).