C26H31F4N5S — CID 142330196
N-(4-amino-2-fluoro-5-methylphenyl)sulfanylpyrimidin-4-amine;N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine (PubChem CID 142330196) has the molecular formula C26H31F4N5S and a molecular weight of 521.63 g/mol. Its IUPAC name is N-(4-amino-2-fluoro-5-methylphenyl)sulfanylpyrimidin-4-amine;N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine.
| Compound Name | N-(4-amino-2-fluoro-5-methylphenyl)sulfanylpyrimidin-4-amine;N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 142330196 |
| Molecular Formula | C26H31F4N5S |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | N-(4-amino-2-fluoro-5-methylphenyl)sulfanylpyrimidin-4-amine;N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine |
| SMILES | CN(C)C1CCCC(c2cccc(C(F)(F)F)c2)C1.Cc1cc(SNc2ccncn2)c(F)cc1N |
| InChI | InChI=1S/C15H20F3N.C11H11FN4S/c1-19(2)14-8-4-6-12(10-14)11-5-3-7-13(9-11)15(16,17)18;1-7-4-10(8(12)5-9(7)13)17-16-11-2-3-14-6-15-11/h3,5,7,9,12,14H,4,6,8,10H2,1-2H3;2-6H,13H2,1H3,(H,14,15,16) |
| InChIKey | LRXXUANYHMASCD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|